C20H19F6N5O — CID 175599259
2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol (PubChem CID 175599259) has the molecular formula C20H19F6N5O and a molecular weight of 459.39 g/mol. Its IUPAC name is 2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 175599259 |
| Molecular Formula | C20H19F6N5O |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]-5-(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)ccc1-c1nnc(N[C@@H]2CCCN(C(F)C(F)F)C2)n2cccc12 |
| InChI | InChI=1S/C20H19F6N5O/c21-17(22)18(23)30-7-1-3-12(10-30)27-19-29-28-16(14-4-2-8-31(14)19)13-6-5-11(9-15(13)32)20(24,25)26/h2,4-6,8-9,12,17-18,32H,1,3,7,10H2,(H,27,29)/t12-,18?/m1/s1 |
| InChIKey | NCZIVHNFYKJNPS-GKOGFXNCSA-N |
| XLogP | 4.56 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|