C13H13F2NO3 — CID 171855290
methyl 1-(2,2-difluoro-2-phenylacetyl)azetidine-3-carboxylate (PubChem CID 171855290) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is methyl 1-(2,2-difluoro-2-phenylacetyl)azetidine-3-carboxylate.
| Compound Name | methyl 1-(2,2-difluoro-2-phenylacetyl)azetidine-3-carboxylate |
|---|---|
| PubChem CID | 171855290 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | methyl 1-(2,2-difluoro-2-phenylacetyl)azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)C(F)(F)c2ccccc2)C1 |
| InChI | InChI=1S/C13H13F2NO3/c1-19-11(17)9-7-16(8-9)12(18)13(14,15)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3 |
| InChIKey | NKCBKKKTCSAHTC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |