C9H11BrO4S — CID 171859835
5-(3-bromo-1,2-dihydroxypropyl)-4-methylthiophene-2-carboxylic acid (PubChem CID 171859835) has the molecular formula C9H11BrO4S and a molecular weight of 295.15 g/mol. Its IUPAC name is 5-(3-bromo-1,2-dihydroxypropyl)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 5-(3-bromo-1,2-dihydroxypropyl)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 171859835 |
| Molecular Formula | C9H11BrO4S |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 5-(3-bromo-1,2-dihydroxypropyl)-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)sc1C(O)C(O)CBr |
| InChI | InChI=1S/C9H11BrO4S/c1-4-2-6(9(13)14)15-8(4)7(12)5(11)3-10/h2,5,7,11-12H,3H2,1H3,(H,13,14) |
| InChIKey | VGZBQQRDQHAGCQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|