C13H14ClNO2 — CID 171862810
1-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]cyclopropane-1-carbonitrile (PubChem CID 171862810) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 1-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 171862810 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2ccc(C(O)C(O)CCl)cc2)CC1 |
| InChI | InChI=1S/C13H14ClNO2/c14-7-11(16)12(17)9-1-3-10(4-2-9)13(8-15)5-6-13/h1-4,11-12,16-17H,5-7H2 |
| InChIKey | UTPXOVCEZARUHD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|