C15H9ClF3N3OS — CID 17186377
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(3-cyano-2-pyridinyl)sulfanyl]acetamide (PubChem CID 17186377) has the molecular formula C15H9ClF3N3OS and a molecular weight of 371.77 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(3-cyano-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(3-cyano-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 17186377 |
| Molecular Formula | C15H9ClF3N3OS |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(3-cyano-2-pyridinyl)sulfanyl]acetamide |
| SMILES | N#Cc1cccnc1SCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H9ClF3N3OS/c16-11-4-3-10(15(17,18)19)6-12(11)22-13(23)8-24-14-9(7-20)2-1-5-21-14/h1-6H,8H2,(H,22,23) |
| InChIKey | DGSMNDMMWZQHDX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |