C12H12N2O5 — CID 171868994
2,3-dihydroxy-3-[4-hydroxy-3-(1,2-oxazol-5-yl)phenyl]propanamide (PubChem CID 171868994) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[4-hydroxy-3-(1,2-oxazol-5-yl)phenyl]propanamide.
| Compound Name | 2,3-dihydroxy-3-[4-hydroxy-3-(1,2-oxazol-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 171868994 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2,3-dihydroxy-3-[4-hydroxy-3-(1,2-oxazol-5-yl)phenyl]propanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc(O)c(-c2ccno2)c1 |
| InChI | InChI=1S/C12H12N2O5/c13-12(18)11(17)10(16)6-1-2-8(15)7(5-6)9-3-4-14-19-9/h1-5,10-11,15-17H,(H2,13,18) |
| InChIKey | KPBGJEFMZRBMKW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |