C26H23BrN4O2S2 — CID 171905477
N-[(E)-(4-bromophenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 171905477) has the molecular formula C26H23BrN4O2S2 and a molecular weight of 567.53 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 171905477 |
| Molecular Formula | C26H23BrN4O2S2 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CC1CCc2c(sc3nc(SCC(=O)N/N=C/c4ccc(Br)cc4)n(-c4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C26H23BrN4O2S2/c1-16-7-12-20-21(13-16)35-24-23(20)25(33)31(19-5-3-2-4-6-19)26(29-24)34-15-22(32)30-28-14-17-8-10-18(27)11-9-17/h2-6,8-11,14,16H,7,12-13,15H2,1H3,(H,30,32)/b28-14+ |
| InChIKey | DTPQBNVHOKXGAD-CCVNUDIWSA-N |
| XLogP | 5.58 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|