C26H24N4O3S2 — CID 171919637
N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 171919637) has the molecular formula C26H24N4O3S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 171919637 |
| Molecular Formula | C26H24N4O3S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CC1CCc2c(sc3nc(SCC(=O)N/N=C/c4ccc(O)cc4)n(-c4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C26H24N4O3S2/c1-16-7-12-20-21(13-16)35-24-23(20)25(33)30(18-5-3-2-4-6-18)26(28-24)34-15-22(32)29-27-14-17-8-10-19(31)11-9-17/h2-6,8-11,14,16,31H,7,12-13,15H2,1H3,(H,29,32)/b27-14+ |
| InChIKey | AABFIJRBBOANMV-MZJWZYIUSA-N |
| XLogP | 4.52 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|