C25H25N5O — CID 171908141
[(3aR,4S,6aS)-2-(1H-imidazol-2-ylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-indol-2-yl)methanone (PubChem CID 171908141) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2-(1H-imidazol-2-ylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [(3aR,4S,6aS)-2-(1H-imidazol-2-ylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 171908141 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | [(3aR,4S,6aS)-2-(1H-imidazol-2-ylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1C[C@@H]2CN(Cc3ncc[nH]3)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H25N5O/c31-25(22-12-18-8-4-5-9-21(18)28-22)30-14-19-13-29(16-23-26-10-11-27-23)15-20(19)24(30)17-6-2-1-3-7-17/h1-12,19-20,24,28H,13-16H2,(H,26,27)/t19-,20-,24+/m0/s1 |
| InChIKey | JJVQDKIGQBZRJH-MZLICYQSSA-N |
| XLogP | 3.84 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |