C23H32N2O4 — CID 171908227
N-[(3R,4S)-1-[2-(1,3-dioxan-2-yl)ethyl]-3-hydroxy-4-phenylpiperidin-4-yl]cyclopent-3-ene-1-carboxamide (PubChem CID 171908227) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[(3R,4S)-1-[2-(1,3-dioxan-2-yl)ethyl]-3-hydroxy-4-phenylpiperidin-4-yl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[(3R,4S)-1-[2-(1,3-dioxan-2-yl)ethyl]-3-hydroxy-4-phenylpiperidin-4-yl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 171908227 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[(3R,4S)-1-[2-(1,3-dioxan-2-yl)ethyl]-3-hydroxy-4-phenylpiperidin-4-yl]cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(N[C@]1(c2ccccc2)CCN(CCC2OCCCO2)C[C@H]1O)C1CC=CC1 |
| InChI | InChI=1S/C23H32N2O4/c26-20-17-25(13-11-21-28-15-6-16-29-21)14-12-23(20,19-9-2-1-3-10-19)24-22(27)18-7-4-5-8-18/h1-5,9-10,18,20-21,26H,6-8,11-17H2,(H,24,27)/t20-,23+/m1/s1 |
| InChIKey | MOLPVPMNQSSPOS-OFNKIYASSA-N |
| XLogP | 2.18 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|