C23H36N2O5S — CID 172896853
N-[(3R,4S)-1-(2-ethylsulfanylethyl)-3-hydroxy-4-phenylpiperidin-4-yl]-4-hydroxycyclohexane-1-carboxamide;formic acid (PubChem CID 172896853) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[(3R,4S)-1-(2-ethylsulfanylethyl)-3-hydroxy-4-phenylpiperidin-4-yl]-4-hydroxycyclohexane-1-carboxamide;formic acid.
| Compound Name | N-[(3R,4S)-1-(2-ethylsulfanylethyl)-3-hydroxy-4-phenylpiperidin-4-yl]-4-hydroxycyclohexane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 172896853 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[(3R,4S)-1-(2-ethylsulfanylethyl)-3-hydroxy-4-phenylpiperidin-4-yl]-4-hydroxycyclohexane-1-carboxamide;formic acid |
| SMILES | CCSCCN1CC[C@](NC(=O)C2CCC(O)CC2)(c2ccccc2)[C@H](O)C1.O=CO |
| InChI | InChI=1S/C22H34N2O3S.CH2O2/c1-2-28-15-14-24-13-12-22(20(26)16-24,18-6-4-3-5-7-18)23-21(27)17-8-10-19(25)11-9-17;2-1-3/h3-7,17,19-20,25-26H,2,8-16H2,1H3,(H,23,27);1H,(H,2,3)/t17?,19?,20-,22+;/m1./s1 |
| InChIKey | BOOIXSYMJUIFKK-KAHZJANBSA-N |
| XLogP | 2.07 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|