C20H26N2O4S2 — CID 171908264
[1-[4-(4-propan-2-ylphenyl)phenyl]sulfonylpyrrolidin-3-yl]methanesulfonamide (PubChem CID 171908264) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is [1-[4-(4-propan-2-ylphenyl)phenyl]sulfonylpyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[4-(4-propan-2-ylphenyl)phenyl]sulfonylpyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 171908264 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [1-[4-(4-propan-2-ylphenyl)phenyl]sulfonylpyrrolidin-3-yl]methanesulfonamide |
| SMILES | CC(C)c1ccc(-c2ccc(S(=O)(=O)N3CCC(CS(N)(=O)=O)C3)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-15(2)17-3-5-18(6-4-17)19-7-9-20(10-8-19)28(25,26)22-12-11-16(13-22)14-27(21,23)24/h3-10,15-16H,11-14H2,1-2H3,(H2,21,23,24) |
| InChIKey | ACSNFRLISNBNIB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |