C25H30N2O2S — CID 46086956
1-(4-propan-2-ylphenyl)sulfonyl-4-[(4-pyrrol-1-ylphenyl)methyl]piperidine (PubChem CID 46086956) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)sulfonyl-4-[(4-pyrrol-1-ylphenyl)methyl]piperidine.
| Compound Name | 1-(4-propan-2-ylphenyl)sulfonyl-4-[(4-pyrrol-1-ylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 46086956 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)sulfonyl-4-[(4-pyrrol-1-ylphenyl)methyl]piperidine |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(Cc3ccc(-n4cccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O2S/c1-20(2)23-7-11-25(12-8-23)30(28,29)27-17-13-22(14-18-27)19-21-5-9-24(10-6-21)26-15-3-4-16-26/h3-12,15-16,20,22H,13-14,17-19H2,1-2H3 |
| InChIKey | PBVDHISKXAHJFH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |