C20H25NO5S — CID 171909560
4-methoxy-3-[4-(methoxymethyl)phenyl]-N-[(3-methyloxetan-3-yl)methyl]benzenesulfonamide (PubChem CID 171909560) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is 4-methoxy-3-[4-(methoxymethyl)phenyl]-N-[(3-methyloxetan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-3-[4-(methoxymethyl)phenyl]-N-[(3-methyloxetan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171909560 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-methoxy-3-[4-(methoxymethyl)phenyl]-N-[(3-methyloxetan-3-yl)methyl]benzenesulfonamide |
| SMILES | COCc1ccc(-c2cc(S(=O)(=O)NCC3(C)COC3)ccc2OC)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-20(13-26-14-20)12-21-27(22,23)17-8-9-19(25-3)18(10-17)16-6-4-15(5-7-16)11-24-2/h4-10,21H,11-14H2,1-3H3 |
| InChIKey | VBAARWMUNMLAEM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |