C15H17NO5S — CID 166288259
N-(2-hydroxyethyl)-4-(5-hydroxy-2-methoxyphenyl)benzenesulfonamide (PubChem CID 166288259) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-(5-hydroxy-2-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-(2-hydroxyethyl)-4-(5-hydroxy-2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166288259 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(2-hydroxyethyl)-4-(5-hydroxy-2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(O)cc1-c1ccc(S(=O)(=O)NCCO)cc1 |
| InChI | InChI=1S/C15H17NO5S/c1-21-15-7-4-12(18)10-14(15)11-2-5-13(6-3-11)22(19,20)16-8-9-17/h2-7,10,16-18H,8-9H2,1H3 |
| InChIKey | HSMFDONAYHHHBO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |