C18H25BrClN3O3 — CID 171916671
tert-butyl N-[1-[(4-bromo-5-chloro-2-methylphenyl)carbamoyl]piperidin-4-yl]carbamate (PubChem CID 171916671) has the molecular formula C18H25BrClN3O3 and a molecular weight of 446.77 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-bromo-5-chloro-2-methylphenyl)carbamoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-bromo-5-chloro-2-methylphenyl)carbamoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 171916671 |
| Molecular Formula | C18H25BrClN3O3 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | tert-butyl N-[1-[(4-bromo-5-chloro-2-methylphenyl)carbamoyl]piperidin-4-yl]carbamate |
| SMILES | Cc1cc(Br)c(Cl)cc1NC(=O)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H25BrClN3O3/c1-11-9-13(19)14(20)10-15(11)22-16(24)23-7-5-12(6-8-23)21-17(25)26-18(2,3)4/h9-10,12H,5-8H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | FBJWCRATQNNCEU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |