C19H27ClN2O4 — CID 55736323
tert-butyl N-[1-[2-(4-chloro-2-methylphenoxy)acetyl]piperidin-4-yl]carbamate (PubChem CID 55736323) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(4-chloro-2-methylphenoxy)acetyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(4-chloro-2-methylphenoxy)acetyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736323 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | tert-butyl N-[1-[2-(4-chloro-2-methylphenoxy)acetyl]piperidin-4-yl]carbamate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H27ClN2O4/c1-13-11-14(20)5-6-16(13)25-12-17(23)22-9-7-15(8-10-22)21-18(24)26-19(2,3)4/h5-6,11,15H,7-10,12H2,1-4H3,(H,21,24) |
| InChIKey | RIEHQNRXCAYLDJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |