C26H25N5O7 — CID 171918803
(2S)-2-[[2-(1H-indol-2-yl)-2-oxoacetyl]amino]-2-(4-nitrophenyl)-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]acetamide (PubChem CID 171918803) has the molecular formula C26H25N5O7 and a molecular weight of 519.51 g/mol. Its IUPAC name is (2S)-2-[[2-(1H-indol-2-yl)-2-oxoacetyl]amino]-2-(4-nitrophenyl)-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]acetamide.
| Compound Name | (2S)-2-[[2-(1H-indol-2-yl)-2-oxoacetyl]amino]-2-(4-nitrophenyl)-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 171918803 |
| Molecular Formula | C26H25N5O7 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (2S)-2-[[2-(1H-indol-2-yl)-2-oxoacetyl]amino]-2-(4-nitrophenyl)-N-[(2S)-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]acetamide |
| SMILES | O=C[C@H](CC1CCCNC1=O)NC(=O)[C@@H](NC(=O)C(=O)c1cc2ccccc2[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H25N5O7/c32-14-18(12-17-5-3-11-27-24(17)34)28-25(35)22(15-7-9-19(10-8-15)31(37)38)30-26(36)23(33)21-13-16-4-1-2-6-20(16)29-21/h1-2,4,6-10,13-14,17-18,22,29H,3,5,11-12H2,(H,27,34)(H,28,35)(H,30,36)/t17?,18-,22-/m0/s1 |
| InChIKey | CNJPRGAURPIEJL-RBENRJQXSA-N |
| XLogP | 1.72 |
| TPSA | 180.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|