C10H11F2N2O3- — CID 171922377
2-[4-amino-6-(difluoromethyl)-5-methoxy-3-methyl-2-pyridinyl]acetate (PubChem CID 171922377) has the molecular formula C10H11F2N2O3- and a molecular weight of 245.20 g/mol. Its IUPAC name is 2-[4-amino-6-(difluoromethyl)-5-methoxy-3-methyl-2-pyridinyl]acetate.
| Compound Name | 2-[4-amino-6-(difluoromethyl)-5-methoxy-3-methyl-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 171922377 |
| Molecular Formula | C10H11F2N2O3- |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-[4-amino-6-(difluoromethyl)-5-methoxy-3-methyl-2-pyridinyl]acetate |
| SMILES | COc1c(C(F)F)nc(CC(=O)[O-])c(C)c1N |
| InChI | InChI=1S/C10H12F2N2O3/c1-4-5(3-6(15)16)14-8(10(11)12)9(17-2)7(4)13/h10H,3H2,1-2H3,(H2,13,14)(H,15,16)/p-1 |
| InChIKey | OPHNPWMLKUATGL-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |