C23H25F6N5O5 — CID 171924063
2-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]indazole-7-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171924063) has the molecular formula C23H25F6N5O5 and a molecular weight of 565.47 g/mol. Its IUPAC name is 2-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]indazole-7-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]indazole-7-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171924063 |
| Molecular Formula | C23H25F6N5O5 |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-[4-[[2-(dimethylamino)ethylamino]methyl]phenyl]indazole-7-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCNCc1ccc(-n2cc3cccc(C(N)=O)c3n2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N5O.2C2HF3O2/c1-23(2)11-10-21-12-14-6-8-16(9-7-14)24-13-15-4-3-5-17(19(20)25)18(15)22-24;2*3-2(4,5)1(6)7/h3-9,13,21H,10-12H2,1-2H3,(H2,20,25);2*(H,6,7) |
| InChIKey | OFTUAEBPIMABOK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|