C22H24F3N5O4 — CID 171929392
2-[3-hydroxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171929392) has the molecular formula C22H24F3N5O4 and a molecular weight of 479.46 g/mol. Its IUPAC name is 2-[3-hydroxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-hydroxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171929392 |
| Molecular Formula | C22H24F3N5O4 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[3-hydroxy-4-[(4-methylpiperazin-1-yl)methyl]phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(Cc2ccc(-n3cc4cccc(C(N)=O)c4n3)cc2O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23N5O2.C2HF3O2/c1-23-7-9-24(10-8-23)12-14-5-6-16(11-18(14)26)25-13-15-3-2-4-17(20(21)27)19(15)22-25;3-2(4,5)1(6)7/h2-6,11,13,26H,7-10,12H2,1H3,(H2,21,27);(H,6,7) |
| InChIKey | CKRODZGXJOHVJJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|