C23H24F3N5O3 — CID 174579090
2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ylmethyl)phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 174579090) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is 2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ylmethyl)phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ylmethyl)phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174579090 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ylmethyl)phenyl]indazole-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc2cn(-c3ccc(CN4CC5CCNC5C4)cc3)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23N5O.C2HF3O2/c22-21(27)18-3-1-2-16-12-26(24-20(16)18)17-6-4-14(5-7-17)10-25-11-15-8-9-23-19(15)13-25;3-2(4,5)1(6)7/h1-7,12,15,19,23H,8-11,13H2,(H2,22,27);(H,6,7) |
| InChIKey | YQLDRGGCCIKXSE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |