C9H16F3NO4S2 — CID 171924939
2-(methoxymethyl)-6-methylsulfanyl-2,3,4,5-tetrahydropyridine;trifluoromethanesulfonic acid (PubChem CID 171924939) has the molecular formula C9H16F3NO4S2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-methylsulfanyl-2,3,4,5-tetrahydropyridine;trifluoromethanesulfonic acid.
| Compound Name | 2-(methoxymethyl)-6-methylsulfanyl-2,3,4,5-tetrahydropyridine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171924939 |
| Molecular Formula | C9H16F3NO4S2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-(methoxymethyl)-6-methylsulfanyl-2,3,4,5-tetrahydropyridine;trifluoromethanesulfonic acid |
| SMILES | COCC1CCCC(SC)=N1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H15NOS.CHF3O3S/c1-10-6-7-4-3-5-8(9-7)11-2;2-1(3,4)8(5,6)7/h7H,3-6H2,1-2H3;(H,5,6,7) |
| InChIKey | DFPDQFGUMZTYIQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|