C6H10F3NO3S3 — CID 158623862
4-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazole;trifluoromethanesulfonic acid (PubChem CID 158623862) has the molecular formula C6H10F3NO3S3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazole;trifluoromethanesulfonic acid.
| Compound Name | 4-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 158623862 |
| Molecular Formula | C6H10F3NO3S3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 4-methyl-2-methylsulfanyl-4,5-dihydro-1,3-thiazole;trifluoromethanesulfonic acid |
| SMILES | CSC1=NC(C)CS1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C5H9NS2.CHF3O3S/c1-4-3-8-5(6-4)7-2;2-1(3,4)8(5,6)7/h4H,3H2,1-2H3;(H,5,6,7) |
| InChIKey | HYIMDANWMPEOQC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|