C28H44F3N3O8 — CID 171927311
6-[3-[(2S,3S,5R)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]hexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 171927311) has the molecular formula C28H44F3N3O8 and a molecular weight of 607.67 g/mol. Its IUPAC name is 6-[3-[(2S,3S,5R)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]hexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[3-[(2S,3S,5R)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]hexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171927311 |
| Molecular Formula | C28H44F3N3O8 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | 6-[3-[(2S,3S,5R)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]hexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](Cc1cccc(OCCCCCC(=O)O)c1)NC(=O)[C@H](C)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H43N3O6.C2HF3O2/c1-4-5-13-28-25(33)18(2)15-23(30)22(29-26(34)19(3)27)17-20-10-9-11-21(16-20)35-14-8-6-7-12-24(31)32;3-2(4,5)1(6)7/h9-11,16,18-19,22-23,30H,4-8,12-15,17,27H2,1-3H3,(H,28,33)(H,29,34)(H,31,32);(H,6,7)/t18-,19+,22+,23+;/m1./s1 |
| InChIKey | PQKRJCPHMNWJOT-QHUCWUINSA-N |
| XLogP | 3.02 |
| TPSA | 188.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|