C25H41N3O6 — CID 91170480
5-[3-[(2S,3S,5S)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]pentanoic acid (PubChem CID 91170480) has the molecular formula C25H41N3O6 and a molecular weight of 479.62 g/mol. Its IUPAC name is 5-[3-[(2S,3S,5S)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]pentanoic acid.
| Compound Name | 5-[3-[(2S,3S,5S)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 91170480 |
| Molecular Formula | C25H41N3O6 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | 5-[3-[(2S,3S,5S)-2-[[(2S)-2-aminopropanoyl]amino]-6-(butylamino)-3-hydroxy-5-methyl-6-oxohexyl]phenoxy]pentanoic acid |
| SMILES | CCCCNC(=O)[C@@H](C)C[C@H](O)[C@H](Cc1cccc(OCCCCC(=O)O)c1)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C25H41N3O6/c1-4-5-12-27-24(32)17(2)14-22(29)21(28-25(33)18(3)26)16-19-9-8-10-20(15-19)34-13-7-6-11-23(30)31/h8-10,15,17-18,21-22,29H,4-7,11-14,16,26H2,1-3H3,(H,27,32)(H,28,33)(H,30,31)/t17-,18-,21-,22-/m0/s1 |
| InChIKey | DIAILLYFNPEAKK-GPHNJDIKSA-N |
| XLogP | 2.00 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|