C19H27F3N2O6S — CID 171927954
2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]azetidin-3-yl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 171927954) has the molecular formula C19H27F3N2O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is 2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]azetidin-3-yl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]azetidin-3-yl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171927954 |
| Molecular Formula | C19H27F3N2O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[1-methyl-3-[(4-pentylphenyl)sulfonylamino]azetidin-3-yl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCc1ccc(S(=O)(=O)NC2(CC(=O)O)CN(C)C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O4S.C2HF3O2/c1-3-4-5-6-14-7-9-15(10-8-14)24(22,23)18-17(11-16(20)21)12-19(2)13-17;3-2(4,5)1(6)7/h7-10,18H,3-6,11-13H2,1-2H3,(H,20,21);(H,6,7) |
| InChIKey | JOGOXYIWTVWVKO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|