C19H31NO4S — CID 90083499
3-ethyl-3-[(4-pentylphenyl)sulfonylamino]hexanoic acid (PubChem CID 90083499) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is 3-ethyl-3-[(4-pentylphenyl)sulfonylamino]hexanoic acid.
| Compound Name | 3-ethyl-3-[(4-pentylphenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 90083499 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 3-ethyl-3-[(4-pentylphenyl)sulfonylamino]hexanoic acid |
| SMILES | CCCCCc1ccc(S(=O)(=O)NC(CC)(CCC)CC(=O)O)cc1 |
| InChI | InChI=1S/C19H31NO4S/c1-4-7-8-9-16-10-12-17(13-11-16)25(23,24)20-19(6-3,14-5-2)15-18(21)22/h10-13,20H,4-9,14-15H2,1-3H3,(H,21,22) |
| InChIKey | QVNDTPOOMFAUCV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|