C22H33NO6 — CID 58596464
3-(carboxymethyl)-3-[(4-octylphenyl)methylamino]pentanedioic acid (PubChem CID 58596464) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-(carboxymethyl)-3-[(4-octylphenyl)methylamino]pentanedioic acid.
| Compound Name | 3-(carboxymethyl)-3-[(4-octylphenyl)methylamino]pentanedioic acid |
|---|---|
| PubChem CID | 58596464 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-(carboxymethyl)-3-[(4-octylphenyl)methylamino]pentanedioic acid |
| SMILES | CCCCCCCCc1ccc(CNC(CC(=O)O)(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C22H33NO6/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)16-23-22(13-19(24)25,14-20(26)27)15-21(28)29/h9-12,23H,2-8,13-16H2,1H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | OVBFNTJZRHFLRH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|