C23H18ClF4NO5S — CID 171929419
CID 171929419 (PubChem CID 171929419) has the molecular formula C23H18ClF4NO5S and a molecular weight of 531.91 g/mol.
| Compound Name | CID 171929419 |
|---|---|
| PubChem CID | 171929419 |
| Molecular Formula | C23H18ClF4NO5S |
| Molecular Weight | 531.91 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | — |
| SMILES | CN(Cc1ccc(OCC(=O)[O-])c(-c2cccc(C(F)(F)F)c2)c1)[S+](=O)(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C23H18ClF4NO5S/c1-29(35(32,33)17-6-7-20(25)19(24)11-17)12-14-5-8-21(34-13-22(30)31)18(9-14)15-3-2-4-16(10-15)23(26,27)28/h2-11H,12-13H2,1H3,(H-,30,31,32,33) |
| InChIKey | UCTPTAZSCASTRA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|