C22H19Cl2FN2O5S — CID 89025870
2-[2-(3-aminophenyl)-5-chloro-4-[[(3-chloro-4-fluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid (PubChem CID 89025870) has the molecular formula C22H19Cl2FN2O5S and a molecular weight of 513.37 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)-5-chloro-4-[[(3-chloro-4-fluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-(3-aminophenyl)-5-chloro-4-[[(3-chloro-4-fluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 89025870 |
| Molecular Formula | C22H19Cl2FN2O5S |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 2-[2-(3-aminophenyl)-5-chloro-4-[[(3-chloro-4-fluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid |
| SMILES | CN(Cc1cc(-c2cccc(N)c2)c(OCC(=O)O)cc1Cl)S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2FN2O5S/c1-27(33(30,31)16-5-6-20(25)19(24)9-16)11-14-8-17(13-3-2-4-15(26)7-13)21(10-18(14)23)32-12-22(28)29/h2-10H,11-12,26H2,1H3,(H,28,29) |
| InChIKey | MJTQPPCIGREIJM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|