C22H20F2N2O5S — CID 89025866
2-[2-(3-aminophenyl)-4-[[(3,4-difluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid (PubChem CID 89025866) has the molecular formula C22H20F2N2O5S and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)-4-[[(3,4-difluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-(3-aminophenyl)-4-[[(3,4-difluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 89025866 |
| Molecular Formula | C22H20F2N2O5S |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-[2-(3-aminophenyl)-4-[[(3,4-difluorophenyl)sulfonyl-methylamino]methyl]phenoxy]acetic acid |
| SMILES | CN(Cc1ccc(OCC(=O)O)c(-c2cccc(N)c2)c1)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H20F2N2O5S/c1-26(32(29,30)17-6-7-19(23)20(24)11-17)12-14-5-8-21(31-13-22(27)28)18(9-14)15-3-2-4-16(25)10-15/h2-11H,12-13,25H2,1H3,(H,27,28) |
| InChIKey | YKEHSIBUSRZXFD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|