C24H21FN2O5S — CID 46898637
2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1H-indol-6-yl)phenoxy]acetic acid (PubChem CID 46898637) has the molecular formula C24H21FN2O5S and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1H-indol-6-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1H-indol-6-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 46898637 |
| Molecular Formula | C24H21FN2O5S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1H-indol-6-yl)phenoxy]acetic acid |
| SMILES | CN(Cc1ccc(OCC(=O)O)c(-c2ccc3cc[nH]c3c2)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FN2O5S/c1-27(33(30,31)20-7-5-19(25)6-8-20)14-16-2-9-23(32-15-24(28)29)21(12-16)18-4-3-17-10-11-26-22(17)13-18/h2-13,26H,14-15H2,1H3,(H,28,29) |
| InChIKey | KDESROQMVGJCQY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |