C21H19FN2O6S — CID 67527728
2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1-oxidopyridin-1-ium-3-yl)phenoxy]acetic acid (PubChem CID 67527728) has the molecular formula C21H19FN2O6S and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1-oxidopyridin-1-ium-3-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1-oxidopyridin-1-ium-3-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 67527728 |
| Molecular Formula | C21H19FN2O6S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-[4-[[(4-fluorophenyl)sulfonyl-methylamino]methyl]-2-(1-oxidopyridin-1-ium-3-yl)phenoxy]acetic acid |
| SMILES | CN(Cc1ccc(OCC(=O)O)c(-c2ccc[n+]([O-])c2)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O6S/c1-23(31(28,29)18-7-5-17(22)6-8-18)12-15-4-9-20(30-14-21(25)26)19(11-15)16-3-2-10-24(27)13-16/h2-11,13H,12,14H2,1H3,(H,25,26) |
| InChIKey | YLHGRTODJFHHJG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|