C9H15F3N2O4S — CID 171930033
2-(2-ethoxyethyl)-1-methylimidazole;trifluoromethanesulfonic acid (PubChem CID 171930033) has the molecular formula C9H15F3N2O4S and a molecular weight of 304.29 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-1-methylimidazole;trifluoromethanesulfonic acid.
| Compound Name | 2-(2-ethoxyethyl)-1-methylimidazole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171930033 |
| Molecular Formula | C9H15F3N2O4S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(2-ethoxyethyl)-1-methylimidazole;trifluoromethanesulfonic acid |
| SMILES | CCOCCc1nccn1C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H14N2O.CHF3O3S/c1-3-11-7-4-8-9-5-6-10(8)2;2-1(3,4)8(5,6)7/h5-6H,3-4,7H2,1-2H3;(H,5,6,7) |
| InChIKey | KQSGSZPJJFPFRZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|