C10H13F3NSn+3 — CID 171930052
N,N-dimethylmethanamine;[4-(trifluoromethyl)phenyl]tin(3+) (PubChem CID 171930052) has the molecular formula C10H13F3NSn+3 and a molecular weight of 322.93 g/mol. Its IUPAC name is N,N-dimethylmethanamine;[4-(trifluoromethyl)phenyl]tin(3+).
| Compound Name | N,N-dimethylmethanamine;[4-(trifluoromethyl)phenyl]tin(3+) |
|---|---|
| PubChem CID | 171930052 |
| Molecular Formula | C10H13F3NSn+3 |
| Molecular Weight | 322.93 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | N,N-dimethylmethanamine;[4-(trifluoromethyl)phenyl]tin(3+) |
| SMILES | CN(C)C.FC(F)(F)c1ccc([Sn+3])cc1 |
| InChI | InChI=1S/C7H4F3.C3H9N.Sn/c8-7(9,10)6-4-2-1-3-5-6;1-4(2)3;/h2-5H;1-3H3;/q;;+3 |
| InChIKey | BXCOEHPWXHLJLR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.93 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |