C35H38F4N4O6 — CID 171932757
4-[2-[2,4-dioxo-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-1-yl]-4-fluorophenyl]-N,N,2-trimethylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 171932757) has the molecular formula C35H38F4N4O6 and a molecular weight of 686.70 g/mol. Its IUPAC name is 4-[2-[2,4-dioxo-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-1-yl]-4-fluorophenyl]-N,N,2-trimethylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[2,4-dioxo-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-1-yl]-4-fluorophenyl]-N,N,2-trimethylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171932757 |
| Molecular Formula | C35H38F4N4O6 |
| Molecular Weight | 686.70 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | 4-[2-[2,4-dioxo-8-[(3-propan-2-yloxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-1-yl]-4-fluorophenyl]-N,N,2-trimethylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(-c2ccc(F)cc2N2C(=O)NC(=O)C23CCN(Cc2cccc(OC(C)C)c2)CC3)ccc1C(=O)N(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H37FN4O4.C2HF3O2/c1-21(2)42-26-8-6-7-23(18-26)20-37-15-13-33(14-16-37)31(40)35-32(41)38(33)29-19-25(34)10-12-28(29)24-9-11-27(22(3)17-24)30(39)36(4)5;3-2(4,5)1(6)7/h6-12,17-19,21H,13-16,20H2,1-5H3,(H,35,40,41);(H,6,7) |
| InChIKey | JIAHMYLIHJSDRV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|