About 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine
1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine (PubChem CID 171934418) has the molecular formula C19H20BrF2NO
and a molecular weight of 396.28 g/mol. Its IUPAC name is 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine |
| PubChem CID | 171934418 |
| Molecular Formula | C19H20BrF2NO |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine |
| SMILES | FC1(F)CCN(Cc2c(Br)cccc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H20BrF2NO/c20-17-7-4-8-18(24-14-15-5-2-1-3-6-15)16(17)13-23-11-9-19(21,22)10-12-23/h1-8H,9-14H2 |
| InChIKey | QKKNHGRDFDEKQM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine?
The IUPAC name of 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine (CID 171934418) is 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine.
What is the SMILES notation for 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine?
The canonical SMILES for 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine is FC1(F)CCN(Cc2c(Br)cccc2OCc2ccccc2)CC1.
What is the InChIKey of 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine?
The InChIKey is QKKNHGRDFDEKQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrF2NO/c20-17-7-4-8-18(24-14-15-5-2-1-3-6-15)16(17)13-23-11-9-19(21,22)10-12-23/h1-8H,9-14H2.
What are the key properties of 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine?
1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine has a molecular weight of 396.28 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-bromo-6-phenylmethoxyphenyl)methyl]-4,4-difluoropiperidine is sourced from PubChem (CID 171934418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).