C15H24N2O4 — CID 171934937
8-O-tert-butyl 9-O-methyl (2R,4R,6R,9R)-1,8-diazatricyclo[4.4.0.02,4]decane-8,9-dicarboxylate (PubChem CID 171934937) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 8-O-tert-butyl 9-O-methyl (2R,4R,6R,9R)-1,8-diazatricyclo[4.4.0.02,4]decane-8,9-dicarboxylate.
| Compound Name | 8-O-tert-butyl 9-O-methyl (2R,4R,6R,9R)-1,8-diazatricyclo[4.4.0.02,4]decane-8,9-dicarboxylate |
|---|---|
| PubChem CID | 171934937 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 8-O-tert-butyl 9-O-methyl (2R,4R,6R,9R)-1,8-diazatricyclo[4.4.0.02,4]decane-8,9-dicarboxylate |
| SMILES | COC(=O)[C@H]1CN2[C@H](C[C@H]3C[C@H]32)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O4/c1-15(2,3)21-14(19)17-7-10-5-9-6-11(9)16(10)8-12(17)13(18)20-4/h9-12H,5-8H2,1-4H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | AYYGDVWGZDSMBI-IRCOFANPSA-N |
| XLogP | 1.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |