C22H23F3N2O — CID 171940283
(9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-[2-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 171940283) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is (9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-[2-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | (9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-[2-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 171940283 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-[2-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | O=C(c1cccnc1C(F)(F)F)C1CC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H23F3N2O/c23-22(24,25)21-19(10-5-11-26-21)20(28)16-12-17-8-4-9-18(13-16)27(17)14-15-6-2-1-3-7-15/h1-3,5-7,10-11,16-18H,4,8-9,12-14H2 |
| InChIKey | KBFAJGJPSRUYPG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |