C17H19F3O3S — CID 171942712
1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone (PubChem CID 171942712) has the molecular formula C17H19F3O3S and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 171942712 |
| Molecular Formula | C17H19F3O3S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C17H19F3O3S/c18-17(19,20)23-13-4-1-3-11(7-13)8-16(21)12-9-14-5-2-6-15(10-12)24(14)22/h1,3-4,7,12,14-15H,2,5-6,8-10H2 |
| InChIKey | HDMLYYINWHLNOY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |