C17H21FOS — CID 171948226
3-(2-fluorophenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one (PubChem CID 171948226) has the molecular formula C17H21FOS and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one.
| Compound Name | 3-(2-fluorophenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one |
|---|---|
| PubChem CID | 171948226 |
| Molecular Formula | C17H21FOS |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-(2-fluorophenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one |
| SMILES | O=C(CCc1ccccc1F)C1CC2CCCC(C1)S2 |
| InChI | InChI=1S/C17H21FOS/c18-16-7-2-1-4-12(16)8-9-17(19)13-10-14-5-3-6-15(11-13)20-14/h1-2,4,7,13-15H,3,5-6,8-11H2 |
| InChIKey | QKFODEUZSVHLJY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |