C20H28OS — CID 171949725
2-(4-tert-butylphenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)ethanone (PubChem CID 171949725) has the molecular formula C20H28OS and a molecular weight of 316.51 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)ethanone.
| Compound Name | 2-(4-tert-butylphenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)ethanone |
|---|---|
| PubChem CID | 171949725 |
| Molecular Formula | C20H28OS |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-(9-thiabicyclo[3.3.1]nonan-3-yl)ethanone |
| SMILES | CC(C)(C)c1ccc(CC(=O)C2CC3CCCC(C2)S3)cc1 |
| InChI | InChI=1S/C20H28OS/c1-20(2,3)16-9-7-14(8-10-16)11-19(21)15-12-17-5-4-6-18(13-15)22-17/h7-10,15,17-18H,4-6,11-13H2,1-3H3 |
| InChIKey | YGNPFZJLNVQUSG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |