C14H15F3OS — CID 171955680
3-[(2,3,4-trifluorophenyl)methyl]-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171955680) has the molecular formula C14H15F3OS and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-[(2,3,4-trifluorophenyl)methyl]-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[(2,3,4-trifluorophenyl)methyl]-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171955680 |
| Molecular Formula | C14H15F3OS |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[(2,3,4-trifluorophenyl)methyl]-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(Cc2ccc(F)c(F)c2F)CC2CCC(C1)S2 |
| InChI | InChI=1S/C14H15F3OS/c15-11-4-1-8(12(16)13(11)17)5-14(18)6-9-2-3-10(7-14)19-9/h1,4,9-10,18H,2-3,5-7H2 |
| InChIKey | MAPXSJXISALSAN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|