C26H37NO2 — CID 171956497
9-benzyl-7-(3,5-dimethyl-1-adamantyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol (PubChem CID 171956497) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 9-benzyl-7-(3,5-dimethyl-1-adamantyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol.
| Compound Name | 9-benzyl-7-(3,5-dimethyl-1-adamantyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 171956497 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 9-benzyl-7-(3,5-dimethyl-1-adamantyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
| SMILES | CC12CC3CC(C)(C1)CC(C1(O)CC4COCC(C1)N4Cc1ccccc1)(C3)C2 |
| InChI | InChI=1S/C26H37NO2/c1-23-8-20-9-24(2,16-23)18-25(10-20,17-23)26(28)11-21-14-29-15-22(12-26)27(21)13-19-6-4-3-5-7-19/h3-7,20-22,28H,8-18H2,1-2H3 |
| InChIKey | WNRYMPKXYRKEEO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |