C14H15F3O3 — CID 171963415
3-[2-(difluoromethoxy)-6-fluorophenyl]-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 171963415) has the molecular formula C14H15F3O3 and a molecular weight of 288.26 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)-6-fluorophenyl]-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[2-(difluoromethoxy)-6-fluorophenyl]-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171963415 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-[2-(difluoromethoxy)-6-fluorophenyl]-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2c(F)cccc2OC(F)F)CC2CCC(C1)O2 |
| InChI | InChI=1S/C14H15F3O3/c15-10-2-1-3-11(20-13(16)17)12(10)14(18)6-8-4-5-9(7-14)19-8/h1-3,8-9,13,18H,4-7H2 |
| InChIKey | DUINPRIVAZSHCD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |