C12H20F3NO — CID 171964310
3-(4,4,4-trifluorobutyl)-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171964310) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutyl)-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(4,4,4-trifluorobutyl)-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171964310 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-(4,4,4-trifluorobutyl)-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | OC1(CCCC(F)(F)F)CC2CCCC(C1)N2 |
| InChI | InChI=1S/C12H20F3NO/c13-12(14,15)6-2-5-11(17)7-9-3-1-4-10(8-11)16-9/h9-10,16-17H,1-8H2 |
| InChIKey | PXCDQLLVPRVEEN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |