C29H25F2NO3 — CID 171965991
9H-fluoren-9-ylmethyl 7-[(3,4-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171965991) has the molecular formula C29H25F2NO3 and a molecular weight of 473.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 7-[(3,4-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 7-[(3,4-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171965991 |
| Molecular Formula | C29H25F2NO3 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 7-[(3,4-difluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1C2C=C(Cc3ccc(F)c(F)c3)CC1COC2 |
| InChI | InChI=1S/C29H25F2NO3/c30-27-10-9-18(14-28(27)31)11-19-12-20-15-34-16-21(13-19)32(20)29(33)35-17-26-24-7-3-1-5-22(24)23-6-2-4-8-25(23)26/h1-10,12,14,20-21,26H,11,13,15-17H2 |
| InChIKey | PKIPQNVIHDRCNN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|