C30H26F3NO4 — CID 171965262
9H-fluoren-9-ylmethyl 7-[[4-(trifluoromethoxy)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171965262) has the molecular formula C30H26F3NO4 and a molecular weight of 521.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 7-[[4-(trifluoromethoxy)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 7-[[4-(trifluoromethoxy)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171965262 |
| Molecular Formula | C30H26F3NO4 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 7-[[4-(trifluoromethoxy)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1C2C=C(Cc3ccc(OC(F)(F)F)cc3)CC1COC2 |
| InChI | InChI=1S/C30H26F3NO4/c31-30(32,33)38-23-11-9-19(10-12-23)13-20-14-21-16-36-17-22(15-20)34(21)29(35)37-18-28-26-7-3-1-5-24(26)25-6-2-4-8-27(25)28/h1-12,14,21-22,28H,13,15-18H2 |
| InChIKey | JKNWVICTDGGZAT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|