C26H27NO3 — CID 171967554
9H-fluoren-9-ylmethyl 7-but-3-enyl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171967554) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 7-but-3-enyl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 7-but-3-enyl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967554 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 7-but-3-enyl-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | C=CCCC1=CC2COCC(C1)N2C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H27NO3/c1-2-3-8-18-13-19-15-29-16-20(14-18)27(19)26(28)30-17-25-23-11-6-4-9-21(23)22-10-5-7-12-24(22)25/h2,4-7,9-13,19-20,25H,1,3,8,14-17H2 |
| InChIKey | OSEKTIKBKQHZLU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|